C20H33N5O10 — CID 58078885
(2S)-2-[[(1R)-1-formyloxy-5-[4-[2-(2-methoxyethoxy)ethoxymethyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 58078885) has the molecular formula C20H33N5O10 and a molecular weight of 503.51 g/mol. Its IUPAC name is (2S)-2-[[(1R)-1-formyloxy-5-[4-[2-(2-methoxyethoxy)ethoxymethyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1R)-1-formyloxy-5-[4-[2-(2-methoxyethoxy)ethoxymethyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 58078885 |
| Molecular Formula | C20H33N5O10 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (2S)-2-[[(1R)-1-formyloxy-5-[4-[2-(2-methoxyethoxy)ethoxymethyl]triazol-1-yl]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | COCCOCCOCc1cn(CCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)OC=O)nn1 |
| InChI | InChI=1S/C20H33N5O10/c1-32-8-9-33-10-11-34-13-15-12-25(24-23-15)7-3-2-4-17(35-14-26)22-20(31)21-16(19(29)30)5-6-18(27)28/h12,14,16-17H,2-11,13H2,1H3,(H,27,28)(H,29,30)(H2,21,22,31)/t16-,17+/m0/s1 |
| InChIKey | TXZGWDXDKQFQFP-DLBZAZTESA-N |
| XLogP | -0.26 |
| TPSA | 200.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|