C17H30N4O9 — CID 177124684
(2S)-2-[[(1R)-3-carboxy-1-formyloxypropyl]carbamoylamino]-6-(2-ethoxyethylcarbamoylamino)hexanoic acid (PubChem CID 177124684) has the molecular formula C17H30N4O9 and a molecular weight of 434.45 g/mol. Its IUPAC name is (2S)-2-[[(1R)-3-carboxy-1-formyloxypropyl]carbamoylamino]-6-(2-ethoxyethylcarbamoylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(1R)-3-carboxy-1-formyloxypropyl]carbamoylamino]-6-(2-ethoxyethylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 177124684 |
| Molecular Formula | C17H30N4O9 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (2S)-2-[[(1R)-3-carboxy-1-formyloxypropyl]carbamoylamino]-6-(2-ethoxyethylcarbamoylamino)hexanoic acid |
| SMILES | CCOCCNC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)OC=O)C(=O)O |
| InChI | InChI=1S/C17H30N4O9/c1-2-29-10-9-19-16(27)18-8-4-3-5-12(15(25)26)20-17(28)21-13(30-11-22)6-7-14(23)24/h11-13H,2-10H2,1H3,(H,23,24)(H,25,26)(H2,18,19,27)(H2,20,21,28)/t12-,13+/m0/s1 |
| InChIKey | RVGBPXSHDVQVEB-QWHCGFSZSA-N |
| XLogP | -0.39 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|