C21H38N4O8 — CID 171057519
(4R)-4-formyloxy-4-[[(1R)-1-formyloxy-5-[6-(propan-2-ylamino)hexanoylamino]pentyl]carbamoylamino]butanoic acid (PubChem CID 171057519) has the molecular formula C21H38N4O8 and a molecular weight of 474.56 g/mol. Its IUPAC name is (4R)-4-formyloxy-4-[[(1R)-1-formyloxy-5-[6-(propan-2-ylamino)hexanoylamino]pentyl]carbamoylamino]butanoic acid.
| Compound Name | (4R)-4-formyloxy-4-[[(1R)-1-formyloxy-5-[6-(propan-2-ylamino)hexanoylamino]pentyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 171057519 |
| Molecular Formula | C21H38N4O8 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (4R)-4-formyloxy-4-[[(1R)-1-formyloxy-5-[6-(propan-2-ylamino)hexanoylamino]pentyl]carbamoylamino]butanoic acid |
| SMILES | CC(C)NCCCCCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)OC=O)OC=O |
| InChI | InChI=1S/C21H38N4O8/c1-16(2)22-12-6-3-4-8-17(28)23-13-7-5-9-18(32-14-26)24-21(31)25-19(33-15-27)10-11-20(29)30/h14-16,18-19,22H,3-13H2,1-2H3,(H,23,28)(H,29,30)(H2,24,25,31)/t18-,19-/m1/s1 |
| InChIKey | RNFLTGKWRAPAPY-RTBURBONSA-N |
| XLogP | 0.99 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|