C31H50N7O11 — CID 58038762
CID 58038762 (PubChem CID 58038762) has the molecular formula C31H50N7O11 and a molecular weight of 696.78 g/mol.
| Compound Name | CID 58038762 |
|---|---|
| PubChem CID | 58038762 |
| Molecular Formula | C31H50N7O11 |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | — |
| SMILES | N[CH]Cc1cn(CCCCC(CC(=O)CCCCCCC(=O)NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O)nn1 |
| InChI | InChI=1S/C31H50N7O11/c32-16-15-22-20-38(37-36-22)18-8-6-9-21(28(43)44)19-23(39)10-3-1-2-4-12-26(40)33-17-7-5-11-24(29(45)46)34-31(49)35-25(30(47)48)13-14-27(41)42/h16,20-21,24-25H,1-15,17-19,32H2,(H,33,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)(H2,34,35,49) |
| InChIKey | BHGHGTZPIWFCAR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 293.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|