C19H28FN5O9 — CID 153411118
(2S)-2-[[(1R)-5-[3-[1-(2-fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoyloxy]pentanedioic acid (PubChem CID 153411118) has the molecular formula C19H28FN5O9 and a molecular weight of 489.46 g/mol. Its IUPAC name is (2S)-2-[[(1R)-5-[3-[1-(2-fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoyloxy]pentanedioic acid.
| Compound Name | (2S)-2-[[(1R)-5-[3-[1-(2-fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoyloxy]pentanedioic acid |
|---|---|
| PubChem CID | 153411118 |
| Molecular Formula | C19H28FN5O9 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (2S)-2-[[(1R)-5-[3-[1-(2-fluoroethyl)triazol-4-yl]propanoylamino]-1-formyloxypentyl]carbamoyloxy]pentanedioic acid |
| SMILES | O=CO[C@H](CCCCNC(=O)CCc1cn(CCF)nn1)NC(=O)O[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H28FN5O9/c20-8-10-25-11-13(23-24-25)4-6-15(27)21-9-2-1-3-16(33-12-26)22-19(32)34-14(18(30)31)5-7-17(28)29/h11-12,14,16H,1-10H2,(H,21,27)(H,22,32)(H,28,29)(H,30,31)/t14-,16+/m0/s1 |
| InChIKey | WTBJWCPOXGPCRD-GOEBONIOSA-N |
| XLogP | 0.01 |
| TPSA | 199.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|