C19H27FN6O8 — CID 144538706
(E)-2-[[(1S)-1-carboxy-5-[[2-[4-(3-fluoropropyl)triazol-1-yl]acetyl]amino]pentyl]carbamoylamino]pent-2-enedioic acid (PubChem CID 144538706) has the molecular formula C19H27FN6O8 and a molecular weight of 486.46 g/mol. Its IUPAC name is (E)-2-[[(1S)-1-carboxy-5-[[2-[4-(3-fluoropropyl)triazol-1-yl]acetyl]amino]pentyl]carbamoylamino]pent-2-enedioic acid.
| Compound Name | (E)-2-[[(1S)-1-carboxy-5-[[2-[4-(3-fluoropropyl)triazol-1-yl]acetyl]amino]pentyl]carbamoylamino]pent-2-enedioic acid |
|---|---|
| PubChem CID | 144538706 |
| Molecular Formula | C19H27FN6O8 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (E)-2-[[(1S)-1-carboxy-5-[[2-[4-(3-fluoropropyl)triazol-1-yl]acetyl]amino]pentyl]carbamoylamino]pent-2-enedioic acid |
| SMILES | O=C(O)C/C=C(/NC(=O)N[C@@H](CCCCNC(=O)Cn1cc(CCCF)nn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H27FN6O8/c20-8-3-4-12-10-26(25-24-12)11-15(27)21-9-2-1-5-13(17(30)31)22-19(34)23-14(18(32)33)6-7-16(28)29/h6,10,13H,1-5,7-9,11H2,(H,21,27)(H,28,29)(H,30,31)(H,32,33)(H2,22,23,34)/b14-6+/t13-/m0/s1 |
| InChIKey | DWGIFHXCZQAHDS-VYAXBHEWSA-N |
| XLogP | -0.34 |
| TPSA | 212.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|