C9H15N5O4 — CID 113314121
2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 113314121) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 113314121 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[[2-[4-(aminomethyl)triazol-1-yl]acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | NCc1cn(CC(=O)NC(CCO)C(=O)O)nn1 |
| InChI | InChI=1S/C9H15N5O4/c10-3-6-4-14(13-12-6)5-8(16)11-7(1-2-15)9(17)18/h4,7,15H,1-3,5,10H2,(H,11,16)(H,17,18) |
| InChIKey | CATCNGPEJRXDDQ-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |