C19H30FN5O6 — CID 145259914
N-butyl-3-[1-(2-fluoroethyl)triazol-4-yl]propanamide;[(2S)-1,5-dioxopentan-2-yl] N-(2-oxoethyl)carbamate (PubChem CID 145259914) has the molecular formula C19H30FN5O6 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-butyl-3-[1-(2-fluoroethyl)triazol-4-yl]propanamide;[(2S)-1,5-dioxopentan-2-yl] N-(2-oxoethyl)carbamate.
| Compound Name | N-butyl-3-[1-(2-fluoroethyl)triazol-4-yl]propanamide;[(2S)-1,5-dioxopentan-2-yl] N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 145259914 |
| Molecular Formula | C19H30FN5O6 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-butyl-3-[1-(2-fluoroethyl)triazol-4-yl]propanamide;[(2S)-1,5-dioxopentan-2-yl] N-(2-oxoethyl)carbamate |
| SMILES | CCCCNC(=O)CCc1cn(CCF)nn1.O=CCC[C@@H](C=O)OC(=O)NCC=O |
| InChI | InChI=1S/C11H19FN4O.C8H11NO5/c1-2-3-7-13-11(17)5-4-10-9-16(8-6-12)15-14-10;10-4-1-2-7(6-12)14-8(13)9-3-5-11/h9H,2-8H2,1H3,(H,13,17);4-7H,1-3H2,(H,9,13)/t;7-/m.0/s1 |
| InChIKey | NPLHMKJIAIHYDB-ZLTKDMPESA-N |
| XLogP | 0.55 |
| TPSA | 149.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|