C9H16N6O2 — CID 154450387
2-methyl-N'-[2-(2H-tetrazol-5-yl)acetyl]pentanehydrazide (PubChem CID 154450387) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-methyl-N'-[2-(2H-tetrazol-5-yl)acetyl]pentanehydrazide.
| Compound Name | 2-methyl-N'-[2-(2H-tetrazol-5-yl)acetyl]pentanehydrazide |
|---|---|
| PubChem CID | 154450387 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-methyl-N'-[2-(2H-tetrazol-5-yl)acetyl]pentanehydrazide |
| SMILES | CCCC(C)C(=O)NNC(=O)Cc1nn[nH]n1 |
| InChI | InChI=1S/C9H16N6O2/c1-3-4-6(2)9(17)13-12-8(16)5-7-10-14-15-11-7/h6H,3-5H2,1-2H3,(H,12,16)(H,13,17)(H,10,11,14,15) |
| InChIKey | OECKHCMEVMLXKU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|