C33H51N5O4 — CID 161194779
2-[[15-[bis(pyridin-2-ylmethyl)amino]-8-oxopentadecyl]carbamoylamino]pentanoic acid (PubChem CID 161194779) has the molecular formula C33H51N5O4 and a molecular weight of 581.80 g/mol. Its IUPAC name is 2-[[15-[bis(pyridin-2-ylmethyl)amino]-8-oxopentadecyl]carbamoylamino]pentanoic acid.
| Compound Name | 2-[[15-[bis(pyridin-2-ylmethyl)amino]-8-oxopentadecyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 161194779 |
| Molecular Formula | C33H51N5O4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | 2-[[15-[bis(pyridin-2-ylmethyl)amino]-8-oxopentadecyl]carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NCCCCCCCC(=O)CCCCCCCN(Cc1ccccn1)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C33H51N5O4/c1-2-17-31(32(40)41)37-33(42)36-24-13-7-3-5-9-20-30(39)21-10-6-4-8-16-25-38(26-28-18-11-14-22-34-28)27-29-19-12-15-23-35-29/h11-12,14-15,18-19,22-23,31H,2-10,13,16-17,20-21,24-27H2,1H3,(H,40,41)(H2,36,37,42) |
| InChIKey | ZQMVFRYXKNCFGU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|