C33H52N6O10 — CID 88967698
6-[[8-[5-[carboxymethyl(pyridin-2-ylmethyl)amino]pentylamino]-8-oxooctanoyl]amino]-2-[(4-carboxy-1-oxobutan-2-yl)carbamoylamino]hexanoic acid (PubChem CID 88967698) has the molecular formula C33H52N6O10 and a molecular weight of 692.81 g/mol. Its IUPAC name is 6-[[8-[5-[carboxymethyl(pyridin-2-ylmethyl)amino]pentylamino]-8-oxooctanoyl]amino]-2-[(4-carboxy-1-oxobutan-2-yl)carbamoylamino]hexanoic acid.
| Compound Name | 6-[[8-[5-[carboxymethyl(pyridin-2-ylmethyl)amino]pentylamino]-8-oxooctanoyl]amino]-2-[(4-carboxy-1-oxobutan-2-yl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 88967698 |
| Molecular Formula | C33H52N6O10 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.37 |
| IUPAC Name | 6-[[8-[5-[carboxymethyl(pyridin-2-ylmethyl)amino]pentylamino]-8-oxooctanoyl]amino]-2-[(4-carboxy-1-oxobutan-2-yl)carbamoylamino]hexanoic acid |
| SMILES | O=CC(CCC(=O)O)NC(=O)NC(CCCCNC(=O)CCCCCCC(=O)NCCCCCN(CC(=O)O)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C33H52N6O10/c40-24-26(16-17-30(43)44)37-33(49)38-27(32(47)48)13-7-10-20-36-29(42)15-5-2-1-4-14-28(41)35-19-8-3-11-21-39(23-31(45)46)22-25-12-6-9-18-34-25/h6,9,12,18,24,26-27H,1-5,7-8,10-11,13-17,19-23H2,(H,35,41)(H,36,42)(H,43,44)(H,45,46)(H,47,48)(H2,37,38,49) |
| InChIKey | XRAVZIITKNGICA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 244.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|