C38H61N7O5 — CID 151908690
6-[[8-[6-[bis(pyridin-2-ylmethyl)amino]hexylamino]-8-oxooctanoyl]amino]-2-(pentan-2-ylcarbamoylamino)hexanoic acid (PubChem CID 151908690) has the molecular formula C38H61N7O5 and a molecular weight of 695.95 g/mol. Its IUPAC name is 6-[[8-[6-[bis(pyridin-2-ylmethyl)amino]hexylamino]-8-oxooctanoyl]amino]-2-(pentan-2-ylcarbamoylamino)hexanoic acid.
| Compound Name | 6-[[8-[6-[bis(pyridin-2-ylmethyl)amino]hexylamino]-8-oxooctanoyl]amino]-2-(pentan-2-ylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 151908690 |
| Molecular Formula | C38H61N7O5 |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.47 |
| IUPAC Name | 6-[[8-[6-[bis(pyridin-2-ylmethyl)amino]hexylamino]-8-oxooctanoyl]amino]-2-(pentan-2-ylcarbamoylamino)hexanoic acid |
| SMILES | CCCC(C)NC(=O)NC(CCCCNC(=O)CCCCCCC(=O)NCCCCCCN(Cc1ccccn1)Cc1ccccn1)C(=O)O |
| InChI | InChI=1S/C38H61N7O5/c1-3-18-31(2)43-38(50)44-34(37(48)49)21-12-16-27-42-36(47)23-9-5-4-8-22-35(46)41-26-13-6-7-17-28-45(29-32-19-10-14-24-39-32)30-33-20-11-15-25-40-33/h10-11,14-15,19-20,24-25,31,34H,3-9,12-13,16-18,21-23,26-30H2,1-2H3,(H,41,46)(H,42,47)(H,48,49)(H2,43,44,50) |
| InChIKey | SUHGBVQUCAFULG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|