C23H39N5O12 — CID 22823809
2-[[4-[2-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoyl]amino]-3-methylbutanoic acid (PubChem CID 22823809) has the molecular formula C23H39N5O12 and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-[[4-[2-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[2-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22823809 |
| Molecular Formula | C23H39N5O12 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[[4-[2-[[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]propanoylamino]-5-amino-5-oxopentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OCC(=O)NC(C)C(=O)NC(CCC(=O)NC(C(=O)O)C(C)C)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H39N5O12/c1-10(2)18(23(38)39)28-16(33)6-5-13(21(24)36)27-22(37)11(3)25-17(34)9-40-20(19(35)15(32)8-30)14(7-29)26-12(4)31/h7,10-11,13-15,18-20,30,32,35H,5-6,8-9H2,1-4H3,(H2,24,36)(H,25,34)(H,26,31)(H,27,37)(H,28,33)(H,38,39)/t11?,13?,14-,15+,18?,19+,20+/m0/s1 |
| InChIKey | VUDFZBHUPIEKMK-ZYXCIUFXSA-N |
| XLogP | -4.73 |
| TPSA | 283.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|