C20H34N4O11 — CID 22823781
4-[[3-[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]methyl]-5-amino-5-oxopentanoic acid (PubChem CID 22823781) has the molecular formula C20H34N4O11 and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[[3-[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]methyl]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[[3-[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]methyl]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22823781 |
| Molecular Formula | C20H34N4O11 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[[3-[2-[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl]oxypropanoylamino]propanoylamino]methyl]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OC(C)C(=O)NCCC(=O)NCC(CCC(=O)O)C(N)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H34N4O11/c1-10(35-18(17(32)14(28)9-26)13(8-25)24-11(2)27)20(34)22-6-5-15(29)23-7-12(19(21)33)3-4-16(30)31/h8,10,12-14,17-18,26,28,32H,3-7,9H2,1-2H3,(H2,21,33)(H,22,34)(H,23,29)(H,24,27)(H,30,31)/t10?,12?,13-,14+,17+,18+/m0/s1 |
| InChIKey | GXOOIFYAECZHAF-MIZBPSQYSA-N |
| XLogP | -4.23 |
| TPSA | 254.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|