C23H34N4O10S — CID 22823830
5-amino-4-[[2-[[2-[(2R,3R,4R,5R)-2-anilino-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylsulfanylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 22823830) has the molecular formula C23H34N4O10S and a molecular weight of 558.61 g/mol. Its IUPAC name is 5-amino-4-[[2-[[2-[(2R,3R,4R,5R)-2-anilino-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylsulfanylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[[2-[[2-[(2R,3R,4R,5R)-2-anilino-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylsulfanylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22823830 |
| Molecular Formula | C23H34N4O10S |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 5-amino-4-[[2-[[2-[(2R,3R,4R,5R)-2-anilino-4,5,6-trihydroxy-1-oxohexan-3-yl]oxyacetyl]amino]-3-methylsulfanylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCC(NC(=O)CO[C@H](C(C=O)Nc1ccccc1)[C@H](O)[C@H](O)CO)C(=O)NC(CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C23H34N4O10S/c1-38-12-16(23(36)27-14(22(24)35)7-8-19(32)33)26-18(31)11-37-21(20(34)17(30)10-29)15(9-28)25-13-5-3-2-4-6-13/h2-6,9,14-17,20-21,25,29-30,34H,7-8,10-12H2,1H3,(H2,24,35)(H,26,31)(H,27,36)(H,32,33)/t14?,15?,16?,17-,20-,21-/m1/s1 |
| InChIKey | WHMGRHGJBOXDCY-FVLSIOMWSA-N |
| XLogP | -2.55 |
| TPSA | 237.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|