C14H28N2O6 — CID 54490675
N-[(2R,3R,4S,5R)-12-amino-3,4,5,6-tetrahydroxy-1-oxododecan-2-yl]acetamide (PubChem CID 54490675) has the molecular formula C14H28N2O6 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-12-amino-3,4,5,6-tetrahydroxy-1-oxododecan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5R)-12-amino-3,4,5,6-tetrahydroxy-1-oxododecan-2-yl]acetamide |
|---|---|
| PubChem CID | 54490675 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[(2R,3R,4S,5R)-12-amino-3,4,5,6-tetrahydroxy-1-oxododecan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)C(O)CCCCCCN |
| InChI | InChI=1S/C14H28N2O6/c1-9(18)16-10(8-17)12(20)14(22)13(21)11(19)6-4-2-3-5-7-15/h8,10-14,19-22H,2-7,15H2,1H3,(H,16,18)/t10-,11?,12+,13+,14-/m0/s1 |
| InChIKey | XVMRSIIDQQSCLF-DDLFLNHLSA-N |
| XLogP | -1.96 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|