C14H23NNa2O17S2 — CID 155487359
disodium;[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-2,4-dihydroxy-6-oxo-1-sulfonatooxyhexan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl sulfate (PubChem CID 155487359) has the molecular formula C14H23NNa2O17S2 and a molecular weight of 587.44 g/mol. Its IUPAC name is disodium;[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-2,4-dihydroxy-6-oxo-1-sulfonatooxyhexan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl sulfate.
| Compound Name | disodium;[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-2,4-dihydroxy-6-oxo-1-sulfonatooxyhexan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 155487359 |
| Molecular Formula | C14H23NNa2O17S2 |
| Molecular Weight | 587.44 g/mol |
| Exact Mass | 587.02 |
| IUPAC Name | disodium;[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-2,4-dihydroxy-6-oxo-1-sulfonatooxyhexan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl sulfate |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](COS(=O)(=O)[O-])[C@H](O)[C@H](O)[C@H]1O)[C@H](O)COS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H25NO17S2.2Na/c1-5(17)15-6(2-16)9(19)13(7(18)3-29-33(23,24)25)32-14-12(22)11(21)10(20)8(31-14)4-30-34(26,27)28;;/h2,6-14,18-22H,3-4H2,1H3,(H,15,17)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2/t6-,7+,8+,9+,10-,11-,12+,13+,14-;;/m0../s1 |
| InChIKey | CUOOXWKMPZJMPD-OVCFVGSBSA-L |
| XLogP | -12.43 |
| TPSA | 298.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.44 |
| LogP ≤ 5 | -12.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|