C14H21NNaO14S — CID 156588735
Heparin disaccharide II-a, sodium salt (PubChem CID 156588735) has the molecular formula C14H21NNaO14S and a molecular weight of 482.37 g/mol.
| Compound Name | Heparin disaccharide II-a, sodium salt |
|---|---|
| PubChem CID | 156588735 |
| Molecular Formula | C14H21NNaO14S |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1OC(C(=O)O)=C[C@H](O)[C@H]1O)[C@H](O)COS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C14H21NO14S.Na/c1-5(17)15-6(3-16)10(20)12(8(19)4-27-30(24,25)26)29-14-11(21)7(18)2-9(28-14)13(22)23;/h2-3,6-8,10-12,14,18-21H,4H2,1H3,(H,15,17)(H,22,23)(H,24,25,26);/t6-,7-,8+,10+,11+,12+,14-;/m0./s1 |
| InChIKey | WUZKLDXYVUXUPB-WYBHFVFNSA-N |
| XLogP | -4.72 |
| TPSA | 246.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|