C14H21NO14S — CID 140874495
(2R,3R,4S)-2-[(2R,3S,4R,5R)-5-acetamido-1-deuteriooxysulfonyloxy-2,4-dihydroxy-6-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 140874495) has the molecular formula C14H21NO14S and a molecular weight of 460.39 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(2R,3S,4R,5R)-5-acetamido-1-deuteriooxysulfonyloxy-2,4-dihydroxy-6-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-2-[(2R,3S,4R,5R)-5-acetamido-1-deuteriooxysulfonyloxy-2,4-dihydroxy-6-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 140874495 |
| Molecular Formula | C14H21NO14S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | (2R,3R,4S)-2-[(2R,3S,4R,5R)-5-acetamido-1-deuteriooxysulfonyloxy-2,4-dihydroxy-6-oxohexan-3-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | [2H]OS(=O)(=O)OC[C@@H](O)[C@@H](O[C@@H]1OC(C(=O)O)=C[C@H](O)[C@H]1O)[C@H](O)[C@H](C=O)NC(C)=O |
| InChI | InChI=1S/C14H21NO14S/c1-5(17)15-6(3-16)10(20)12(8(19)4-27-30(24,25)26)29-14-11(21)7(18)2-9(28-14)13(22)23/h2-3,6-8,10-12,14,18-21H,4H2,1H3,(H,15,17)(H,22,23)(H,24,25,26)/t6-,7-,8+,10+,11+,12+,14-/m0/s1/i/hD |
| InChIKey | UHXYFGURITUJOM-NEPJXRGQSA-N |
| XLogP | -4.34 |
| TPSA | 246.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|