C8H16NO9P — CID 87770691
[2-oxo-2-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]ethyl]phosphonic acid (PubChem CID 87770691) has the molecular formula C8H16NO9P and a molecular weight of 301.19 g/mol. Its IUPAC name is [2-oxo-2-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]ethyl]phosphonic acid.
| Compound Name | [2-oxo-2-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 87770691 |
| Molecular Formula | C8H16NO9P |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [2-oxo-2-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]ethyl]phosphonic acid |
| SMILES | O=C[C@H](NC(=O)CP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16NO9P/c10-1-4(7(14)8(15)5(12)2-11)9-6(13)3-19(16,17)18/h1,4-5,7-8,11-12,14-15H,2-3H2,(H,9,13)(H2,16,17,18)/t4-,5+,7+,8+/m0/s1 |
| InChIKey | JNRWXNDQWAXHBK-LRSZDJBLSA-N |
| XLogP | -4.08 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|