C13H15Cl — CID 174732594
3-(chloromethyl)hexa-1,4-dienylbenzene (PubChem CID 174732594) has the molecular formula C13H15Cl and a molecular weight of 206.72 g/mol. Its IUPAC name is 3-(chloromethyl)hexa-1,4-dienylbenzene.
| Compound Name | 3-(chloromethyl)hexa-1,4-dienylbenzene |
|---|---|
| PubChem CID | 174732594 |
| Molecular Formula | C13H15Cl |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(chloromethyl)hexa-1,4-dienylbenzene |
| SMILES | CC=CC(C=Cc1ccccc1)CCl |
| InChI | InChI=1S/C13H15Cl/c1-2-6-13(11-14)10-9-12-7-4-3-5-8-12/h2-10,13H,11H2,1H3 |
| InChIKey | VLJZYZAGGBZVDT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|