C17H20F2O4 — CID 141254134
tert-butyl (E)-4,4-difluoro-5-hydroxy-3-oxo-7-phenylhept-6-enoate (PubChem CID 141254134) has the molecular formula C17H20F2O4 and a molecular weight of 326.34 g/mol. Its IUPAC name is tert-butyl (E)-4,4-difluoro-5-hydroxy-3-oxo-7-phenylhept-6-enoate.
| Compound Name | tert-butyl (E)-4,4-difluoro-5-hydroxy-3-oxo-7-phenylhept-6-enoate |
|---|---|
| PubChem CID | 141254134 |
| Molecular Formula | C17H20F2O4 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | tert-butyl (E)-4,4-difluoro-5-hydroxy-3-oxo-7-phenylhept-6-enoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)C(F)(F)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H20F2O4/c1-16(2,3)23-15(22)11-14(21)17(18,19)13(20)10-9-12-7-5-4-6-8-12/h4-10,13,20H,11H2,1-3H3/b10-9+ |
| InChIKey | AGCWXMYWWDRTSW-MDZDMXLPSA-N |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|