C10H10BrNO3 — CID 25111497
(E,1S,2S)-1-bromo-1-nitro-4-phenylbut-3-en-2-ol (PubChem CID 25111497) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is (E,1S,2S)-1-bromo-1-nitro-4-phenylbut-3-en-2-ol.
| Compound Name | (E,1S,2S)-1-bromo-1-nitro-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 25111497 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | (E,1S,2S)-1-bromo-1-nitro-4-phenylbut-3-en-2-ol |
| SMILES | O=[N+]([O-])[C@@H](Br)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H10BrNO3/c11-10(12(14)15)9(13)7-6-8-4-2-1-3-5-8/h1-7,9-10,13H/b7-6+/t9-,10+/m0/s1 |
| InChIKey | UFCZENFTKGNANS-LOSXEJPUSA-N |
| XLogP | 2.06 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|