C13H15NO3S — CID 66559307
S-[(E,3S,4R)-4-nitro-1-phenylpent-1-en-3-yl] ethanethioate (PubChem CID 66559307) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is S-[(E,3S,4R)-4-nitro-1-phenylpent-1-en-3-yl] ethanethioate.
| Compound Name | S-[(E,3S,4R)-4-nitro-1-phenylpent-1-en-3-yl] ethanethioate |
|---|---|
| PubChem CID | 66559307 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | S-[(E,3S,4R)-4-nitro-1-phenylpent-1-en-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H](/C=C/c1ccccc1)[C@@H](C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO3S/c1-10(14(16)17)13(18-11(2)15)9-8-12-6-4-3-5-7-12/h3-10,13H,1-2H3/b9-8+/t10-,13+/m1/s1 |
| InChIKey | CCXGQZKBUMHUPO-HWWWMWNKSA-N |
| XLogP | 3.01 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|