C12H17NO3S — CID 15212439
(E)-2-hydroxy-N,N-dimethyl-4-phenylbut-3-ene-1-sulfonamide (PubChem CID 15212439) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is (E)-2-hydroxy-N,N-dimethyl-4-phenylbut-3-ene-1-sulfonamide.
| Compound Name | (E)-2-hydroxy-N,N-dimethyl-4-phenylbut-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 15212439 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (E)-2-hydroxy-N,N-dimethyl-4-phenylbut-3-ene-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CC(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H17NO3S/c1-13(2)17(15,16)10-12(14)9-8-11-6-4-3-5-7-11/h3-9,12,14H,10H2,1-2H3/b9-8+ |
| InChIKey | JEFREMNZPJRIRA-CMDGGOBGSA-N |
| XLogP | 0.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |