C23H38NO6P — CID 11271009
tert-butyl N-[(2S,4R)-6-dimethoxyphosphoryl-2,4-dimethyl-5-oxohexyl]-N-[(1R)-1-phenylethyl]carbamate (PubChem CID 11271009) has the molecular formula C23H38NO6P and a molecular weight of 455.53 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-6-dimethoxyphosphoryl-2,4-dimethyl-5-oxohexyl]-N-[(1R)-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-6-dimethoxyphosphoryl-2,4-dimethyl-5-oxohexyl]-N-[(1R)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 11271009 |
| Molecular Formula | C23H38NO6P |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl N-[(2S,4R)-6-dimethoxyphosphoryl-2,4-dimethyl-5-oxohexyl]-N-[(1R)-1-phenylethyl]carbamate |
| SMILES | COP(=O)(CC(=O)[C@H](C)C[C@H](C)CN(C(=O)OC(C)(C)C)[C@H](C)c1ccccc1)OC |
| InChI | InChI=1S/C23H38NO6P/c1-17(14-18(2)21(25)16-31(27,28-7)29-8)15-24(22(26)30-23(4,5)6)19(3)20-12-10-9-11-13-20/h9-13,17-19H,14-16H2,1-8H3/t17-,18+,19+/m0/s1 |
| InChIKey | DACGJNALKGEWJD-IPMKNSEASA-N |
| XLogP | 5.70 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|