C22H34N2 — CID 2845763
1-(2,6-dimethylhept-5-enyl)-4-(3-phenylprop-2-enyl)piperazine (PubChem CID 2845763) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-(2,6-dimethylhept-5-enyl)-4-(3-phenylprop-2-enyl)piperazine.
| Compound Name | 1-(2,6-dimethylhept-5-enyl)-4-(3-phenylprop-2-enyl)piperazine |
|---|---|
| PubChem CID | 2845763 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 1-(2,6-dimethylhept-5-enyl)-4-(3-phenylprop-2-enyl)piperazine |
| SMILES | CC(C)=CCCC(C)CN1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H34N2/c1-20(2)9-7-10-21(3)19-24-17-15-23(16-18-24)14-8-13-22-11-5-4-6-12-22/h4-6,8-9,11-13,21H,7,10,14-19H2,1-3H3 |
| InChIKey | OAESBAAOJNZKTB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|