C36H44O6 — CID 21302043
2,3-bis[(4-tert-butylbenzoyl)oxy]propyl 4-tert-butylbenzoate (PubChem CID 21302043) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is 2,3-bis[(4-tert-butylbenzoyl)oxy]propyl 4-tert-butylbenzoate.
| Compound Name | 2,3-bis[(4-tert-butylbenzoyl)oxy]propyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 21302043 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 2,3-bis[(4-tert-butylbenzoyl)oxy]propyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(COC(=O)c2ccc(C(C)(C)C)cc2)OC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H44O6/c1-34(2,3)27-16-10-24(11-17-27)31(37)40-22-30(42-33(39)26-14-20-29(21-15-26)36(7,8)9)23-41-32(38)25-12-18-28(19-13-25)35(4,5)6/h10-21,30H,22-23H2,1-9H3 |
| InChIKey | APRKCMFYGWNFNB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|