C20H28O5S — CID 130312983
[1-prop-2-enoyloxy-3-(3-sulfanylpropoxy)propan-2-yl] 4-tert-butylbenzoate (PubChem CID 130312983) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is [1-prop-2-enoyloxy-3-(3-sulfanylpropoxy)propan-2-yl] 4-tert-butylbenzoate.
| Compound Name | [1-prop-2-enoyloxy-3-(3-sulfanylpropoxy)propan-2-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 130312983 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [1-prop-2-enoyloxy-3-(3-sulfanylpropoxy)propan-2-yl] 4-tert-butylbenzoate |
| SMILES | C=CC(=O)OCC(COCCCS)OC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28O5S/c1-5-18(21)24-14-17(13-23-11-6-12-26)25-19(22)15-7-9-16(10-8-15)20(2,3)4/h5,7-10,17,26H,1,6,11-14H2,2-4H3 |
| InChIKey | WJJYJTRQDUBOIR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|