C43H58O7 — CID 18724486
2-[1-[4-[7-(4-acetyloxyphenyl)-5-(4-hydroxyphenyl)octan-3-yl]phenoxy]ethoxy]ethyl 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 18724486) has the molecular formula C43H58O7 and a molecular weight of 686.93 g/mol. Its IUPAC name is 2-[1-[4-[7-(4-acetyloxyphenyl)-5-(4-hydroxyphenyl)octan-3-yl]phenoxy]ethoxy]ethyl 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | 2-[1-[4-[7-(4-acetyloxyphenyl)-5-(4-hydroxyphenyl)octan-3-yl]phenoxy]ethoxy]ethyl 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18724486 |
| Molecular Formula | C43H58O7 |
| Molecular Weight | 686.93 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | 2-[1-[4-[7-(4-acetyloxyphenyl)-5-(4-hydroxyphenyl)octan-3-yl]phenoxy]ethoxy]ethyl 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CCC(CC(CC(C)c1ccc(OC(C)=O)cc1)c1ccc(O)cc1)c1ccc(OC(C)OCCOC(=O)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C43H58O7/c1-8-32(28-37(35-11-19-39(45)20-12-35)27-29(2)33-13-21-40(22-14-33)49-30(3)44)34-15-23-41(24-16-34)50-31(4)47-25-26-48-42(46)36-9-17-38(18-10-36)43(5,6)7/h11-16,19-24,29,31-32,36-38,45H,8-10,17-18,25-28H2,1-7H3 |
| InChIKey | FZAVJCHYAPGNFZ-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.93 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|