C21H28O2 — CID 21363352
1-[1-(4-butan-2-ylphenoxy)ethoxymethyl]-2,4-dimethylbenzene (PubChem CID 21363352) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-[1-(4-butan-2-ylphenoxy)ethoxymethyl]-2,4-dimethylbenzene.
| Compound Name | 1-[1-(4-butan-2-ylphenoxy)ethoxymethyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 21363352 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[1-(4-butan-2-ylphenoxy)ethoxymethyl]-2,4-dimethylbenzene |
| SMILES | CCC(C)c1ccc(OC(C)OCc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H28O2/c1-6-16(3)19-9-11-21(12-10-19)23-18(5)22-14-20-8-7-15(2)13-17(20)4/h7-13,16,18H,6,14H2,1-5H3 |
| InChIKey | HPPIDLHINOCQHH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|