C25H39NaO7S — CID 58819383
sodium 4-[4,6-bis(butoxycarbonyl)-6-methyloctan-2-yl]benzenesulfonate (PubChem CID 58819383) has the molecular formula C25H39NaO7S and a molecular weight of 506.64 g/mol. Its IUPAC name is sodium 4-[4,6-bis(butoxycarbonyl)-6-methyloctan-2-yl]benzenesulfonate.
| Compound Name | sodium 4-[4,6-bis(butoxycarbonyl)-6-methyloctan-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 58819383 |
| Molecular Formula | C25H39NaO7S |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | sodium 4-[4,6-bis(butoxycarbonyl)-6-methyloctan-2-yl]benzenesulfonate |
| SMILES | CCCCOC(=O)C(CC(C)c1ccc(S(=O)(=O)[O-])cc1)CC(C)(CC)C(=O)OCCCC.[Na+] |
| InChI | InChI=1S/C25H40O7S.Na/c1-6-9-15-31-23(26)21(18-25(5,8-3)24(27)32-16-10-7-2)17-19(4)20-11-13-22(14-12-20)33(28,29)30;/h11-14,19,21H,6-10,15-18H2,1-5H3,(H,28,29,30);/q;+1/p-1 |
| InChIKey | WRYVVIHKIKWRCP-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|