C14H18ClNaO5S — CID 23668136
sodium 4-(2-chloro-2-ethylhexanoyl)oxybenzenesulfonate (PubChem CID 23668136) has the molecular formula C14H18ClNaO5S and a molecular weight of 356.80 g/mol. Its IUPAC name is sodium 4-(2-chloro-2-ethylhexanoyl)oxybenzenesulfonate.
| Compound Name | sodium 4-(2-chloro-2-ethylhexanoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 23668136 |
| Molecular Formula | C14H18ClNaO5S |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | sodium 4-(2-chloro-2-ethylhexanoyl)oxybenzenesulfonate |
| SMILES | CCCCC(Cl)(CC)C(=O)Oc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C14H19ClO5S.Na/c1-3-5-10-14(15,4-2)13(16)20-11-6-8-12(9-7-11)21(17,18)19;/h6-9H,3-5,10H2,1-2H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | RAUCUINPPROCER-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|