C42H46N2O4 — CID 59623032
5-O-butyl 1-O-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl] 2-ethyl-2-methyl-4-(2-phenylpropyl)pentanedioate (PubChem CID 59623032) has the molecular formula C42H46N2O4 and a molecular weight of 642.84 g/mol. Its IUPAC name is 5-O-butyl 1-O-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl] 2-ethyl-2-methyl-4-(2-phenylpropyl)pentanedioate.
| Compound Name | 5-O-butyl 1-O-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl] 2-ethyl-2-methyl-4-(2-phenylpropyl)pentanedioate |
|---|---|
| PubChem CID | 59623032 |
| Molecular Formula | C42H46N2O4 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | 5-O-butyl 1-O-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl] 2-ethyl-2-methyl-4-(2-phenylpropyl)pentanedioate |
| SMILES | CCCCOC(=O)C(CC(C)c1ccccc1)CC(C)(CC)C(=O)Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C42H46N2O4/c1-5-7-27-47-40(45)35(28-30(3)31-17-11-8-12-18-31)29-42(4,6-2)41(46)48-36-25-23-34(24-26-36)39-43-37(32-19-13-9-14-20-32)38(44-39)33-21-15-10-16-22-33/h8-26,30,35H,5-7,27-29H2,1-4H3,(H,43,44) |
| InChIKey | IVCXTMXUUZGAAL-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|