About 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane
2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane (PubChem CID 160827307) has the molecular formula C23H40O3
and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane |
| PubChem CID | 160827307 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane |
| SMILES | C.C.C.C.CCC(CC(C)c1ccc2ccccc2c1)C(=O)OCCO |
| InChI | InChI=1S/C19H24O3.4CH4/c1-3-15(19(21)22-11-10-20)12-14(2)17-9-8-16-6-4-5-7-18(16)13-17;;;;/h4-9,13-15,20H,3,10-12H2,1-2H3;4*1H4 |
| InChIKey | SGIUEDYLXDJTJW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane?
The IUPAC name of 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane (CID 160827307) is 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane.
What is the SMILES notation for 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane?
The canonical SMILES for 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane is C.C.C.C.CCC(CC(C)c1ccc2ccccc2c1)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane?
The InChIKey is SGIUEDYLXDJTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O3.4CH4/c1-3-15(19(21)22-11-10-20)12-14(2)17-9-8-16-6-4-5-7-18(16)13-17;;;;/h4-9,13-15,20H,3,10-12H2,1-2H3;4*1H4.
What are the key properties of 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane?
2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane has a molecular weight of 364.57 g/mol, XLogP of 6.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-ethyl-4-naphthalen-2-ylpentanoate;methane is sourced from PubChem (CID 160827307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).