C13H21FN2O — CID 107692701
3-[4-(2-aminoethyl)-2-fluorophenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 107692701) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-2-fluorophenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-(2-aminoethyl)-2-fluorophenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 107692701 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-[4-(2-aminoethyl)-2-fluorophenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc(CCN)cc1F |
| InChI | InChI=1S/C13H21FN2O/c1-16(2)8-3-9-17-13-5-4-11(6-7-15)10-12(13)14/h4-5,10H,3,6-9,15H2,1-2H3 |
| InChIKey | MGKIWXSFLQADBC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|