C12H17NO3 — CID 146277523
2-(3,4-dimethylphenoxy)ethyl-methylcarbamic acid (PubChem CID 146277523) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)ethyl-methylcarbamic acid.
| Compound Name | 2-(3,4-dimethylphenoxy)ethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 146277523 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)ethyl-methylcarbamic acid |
| SMILES | Cc1ccc(OCCN(C)C(=O)O)cc1C |
| InChI | InChI=1S/C12H17NO3/c1-9-4-5-11(8-10(9)2)16-7-6-13(3)12(14)15/h4-5,8H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | CDIYRXYHTZVTAW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |