C35H48O17 — CID 11193481
3-[[3-[[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methoxy]-5-[(2-carboxyacetyl)oxymethyl]phenyl]methoxy]-3-oxopropanoic acid (PubChem CID 11193481) has the molecular formula C35H48O17 and a molecular weight of 740.75 g/mol. Its IUPAC name is 3-[[3-[[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methoxy]-5-[(2-carboxyacetyl)oxymethyl]phenyl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[3-[[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methoxy]-5-[(2-carboxyacetyl)oxymethyl]phenyl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 11193481 |
| Molecular Formula | C35H48O17 |
| Molecular Weight | 740.75 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 3-[[3-[[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methoxy]-5-[(2-carboxyacetyl)oxymethyl]phenyl]methoxy]-3-oxopropanoic acid |
| SMILES | COCCOCCOCCOc1cc(COc2cc(COC(=O)CC(=O)O)cc(COC(=O)CC(=O)O)c2)cc(OCCOCCOCCOC)c1 |
| InChI | InChI=1S/C35H48O17/c1-42-3-5-44-7-9-46-11-13-48-30-18-28(19-31(20-30)49-14-12-47-10-8-45-6-4-43-2)23-50-29-16-26(24-51-34(40)21-32(36)37)15-27(17-29)25-52-35(41)22-33(38)39/h15-20H,3-14,21-25H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | FOKWZMFWPFLUPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 210.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|