C35H48O10 — CID 134166680
1,3-bis(2-methoxyethoxy)-5-[[3-[[3-(2-methoxyethoxy)-5-(methoxymethoxy)phenyl]methoxy]-5-(2-methylpropyl)phenoxy]methyl]benzene (PubChem CID 134166680) has the molecular formula C35H48O10 and a molecular weight of 628.76 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethoxy)-5-[[3-[[3-(2-methoxyethoxy)-5-(methoxymethoxy)phenyl]methoxy]-5-(2-methylpropyl)phenoxy]methyl]benzene.
| Compound Name | 1,3-bis(2-methoxyethoxy)-5-[[3-[[3-(2-methoxyethoxy)-5-(methoxymethoxy)phenyl]methoxy]-5-(2-methylpropyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 134166680 |
| Molecular Formula | C35H48O10 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | 1,3-bis(2-methoxyethoxy)-5-[[3-[[3-(2-methoxyethoxy)-5-(methoxymethoxy)phenyl]methoxy]-5-(2-methylpropyl)phenoxy]methyl]benzene |
| SMILES | COCCOc1cc(COc2cc(CC(C)C)cc(OCc3cc(OCCOC)cc(OCOC)c3)c2)cc(OCCOC)c1 |
| InChI | InChI=1S/C35H48O10/c1-26(2)13-27-14-33(43-23-28-16-30(40-10-7-36-3)20-31(17-28)41-11-8-37-4)22-34(15-27)44-24-29-18-32(42-12-9-38-5)21-35(19-29)45-25-39-6/h14-22,26H,7-13,23-25H2,1-6H3 |
| InChIKey | AVWYPUZTSOVESU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|