C22H17F21OS2 — CID 102066230
5-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecylsulfanyl)phenoxy]pentane-1-thiol (PubChem CID 102066230) has the molecular formula C22H17F21OS2 and a molecular weight of 760.47 g/mol. Its IUPAC name is 5-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecylsulfanyl)phenoxy]pentane-1-thiol.
| Compound Name | 5-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecylsulfanyl)phenoxy]pentane-1-thiol |
|---|---|
| PubChem CID | 102066230 |
| Molecular Formula | C22H17F21OS2 |
| Molecular Weight | 760.47 g/mol |
| Exact Mass | 760.04 |
| IUPAC Name | 5-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecylsulfanyl)phenoxy]pentane-1-thiol |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CSc1ccc(OCCCCCS)cc1 |
| InChI | InChI=1S/C22H17F21OS2/c23-13(24,10-46-12-6-4-11(5-7-12)44-8-2-1-3-9-45)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)19(35,36)20(37,38)21(39,40)22(41,42)43/h4-7,45H,1-3,8-10H2 |
| InChIKey | LELMNBNMMQHEKH-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.47 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|