C16H15BrF9IO — CID 162401992
1-bromo-4-(7,7,8,8,9,9,10,10,10-nonafluoro-5-iododecoxy)benzene (PubChem CID 162401992) has the molecular formula C16H15BrF9IO and a molecular weight of 601.09 g/mol. Its IUPAC name is 1-bromo-4-(7,7,8,8,9,9,10,10,10-nonafluoro-5-iododecoxy)benzene.
| Compound Name | 1-bromo-4-(7,7,8,8,9,9,10,10,10-nonafluoro-5-iododecoxy)benzene |
|---|---|
| PubChem CID | 162401992 |
| Molecular Formula | C16H15BrF9IO |
| Molecular Weight | 601.09 g/mol |
| Exact Mass | 599.92 |
| IUPAC Name | 1-bromo-4-(7,7,8,8,9,9,10,10,10-nonafluoro-5-iododecoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)CCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrF9IO/c17-10-4-6-12(7-5-10)28-8-2-1-3-11(27)9-13(18,19)14(20,21)15(22,23)16(24,25)26/h4-7,11H,1-3,8-9H2 |
| InChIKey | UJMYUHGDHWWZQR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.09 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|