C17H9F17I2O — CID 162537306
1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundecoxy)-4-iodobenzene (PubChem CID 162537306) has the molecular formula C17H9F17I2O and a molecular weight of 806.03 g/mol. Its IUPAC name is 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundecoxy)-4-iodobenzene.
| Compound Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundecoxy)-4-iodobenzene |
|---|---|
| PubChem CID | 162537306 |
| Molecular Formula | C17H9F17I2O |
| Molecular Weight | 806.03 g/mol |
| Exact Mass | 805.85 |
| IUPAC Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-iodoundecoxy)-4-iodobenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)COc1ccc(I)cc1 |
| InChI | InChI=1S/C17H9F17I2O/c18-10(19,5-8(36)6-37-9-3-1-7(35)2-4-9)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h1-4,8H,5-6H2 |
| InChIKey | OQOKJVSVCANYBS-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.03 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|