C26H18F26I2 — CID 162538617
1,2-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-iododecyl)benzene (PubChem CID 162538617) has the molecular formula C26H18F26I2 and a molecular weight of 1078.19 g/mol. Its IUPAC name is 1,2-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-iododecyl)benzene.
| Compound Name | 1,2-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-iododecyl)benzene |
|---|---|
| PubChem CID | 162538617 |
| Molecular Formula | C26H18F26I2 |
| Molecular Weight | 1078.19 g/mol |
| Exact Mass | 1077.91 |
| IUPAC Name | 1,2-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-iododecyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)CCc1ccccc1CCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H18F26I2/c27-15(28,17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49)9-13(53)7-5-11-3-1-2-4-12(11)6-8-14(54)10-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52/h1-4,13-14H,5-10H2 |
| InChIKey | LHNRMQZEQWPWNQ-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.19 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|