C16H15F11O — CID 156764712
3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(2-propylphenyl)heptan-1-ol (PubChem CID 156764712) has the molecular formula C16H15F11O and a molecular weight of 432.27 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(2-propylphenyl)heptan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(2-propylphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 156764712 |
| Molecular Formula | C16H15F11O |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(2-propylphenyl)heptan-1-ol |
| SMILES | CCCc1ccccc1C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H15F11O/c1-2-5-9-6-3-4-7-10(9)11(28)8-12(17,18)13(19,20)14(21,22)15(23,24)16(25,26)27/h3-4,6-7,11,28H,2,5,8H2,1H3 |
| InChIKey | JUAVKNCJJZUUDO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|