C20H18N2O2 — CID 71367381
4-[3-(4-butoxyphenyl)-1,2-oxazol-5-yl]benzonitrile (PubChem CID 71367381) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-[3-(4-butoxyphenyl)-1,2-oxazol-5-yl]benzonitrile.
| Compound Name | 4-[3-(4-butoxyphenyl)-1,2-oxazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 71367381 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-[3-(4-butoxyphenyl)-1,2-oxazol-5-yl]benzonitrile |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(C#N)cc3)on2)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-2-3-12-23-18-10-8-16(9-11-18)19-13-20(24-22-19)17-6-4-15(14-21)5-7-17/h4-11,13H,2-3,12H2,1H3 |
| InChIKey | UBBILEMPRIDVIT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|