C21H20NO5P — CID 121382191
phosphoroso 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate (PubChem CID 121382191) has the molecular formula C21H20NO5P and a molecular weight of 397.37 g/mol. Its IUPAC name is phosphoroso 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate.
| Compound Name | phosphoroso 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 121382191 |
| Molecular Formula | C21H20NO5P |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | phosphoroso 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(C(=O)OP=O)cc3)no2)cc1 |
| InChI | InChI=1S/C21H20NO5P/c1-2-3-4-13-25-18-11-9-16(10-12-18)20-14-19(22-26-20)15-5-7-17(8-6-15)21(23)27-28-24/h5-12,14H,2-4,13H2,1H3 |
| InChIKey | JCFUFUAIKXZWON-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|