C26H31N3O5 — CID 87174173
[(2S)-2,5-diaminopentanoyl] 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate (PubChem CID 87174173) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is [(2S)-2,5-diaminopentanoyl] 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate.
| Compound Name | [(2S)-2,5-diaminopentanoyl] 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 87174173 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [(2S)-2,5-diaminopentanoyl] 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(C(=O)OC(=O)[C@@H](N)CCCN)cc3)no2)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-2-3-4-16-32-21-13-11-19(12-14-21)24-17-23(29-34-24)18-7-9-20(10-8-18)25(30)33-26(31)22(28)6-5-15-27/h7-14,17,22H,2-6,15-16,27-28H2,1H3/t22-/m0/s1 |
| InChIKey | CJKVOAVZJONKGR-QFIPXVFZSA-N |
| XLogP | 4.33 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|