C24H23N3O3S2 — CID 71510011
S-(5-methyl-1,3,4-thiadiazol-2-yl) 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzenecarbothioate (PubChem CID 71510011) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is S-(5-methyl-1,3,4-thiadiazol-2-yl) 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzenecarbothioate.
| Compound Name | S-(5-methyl-1,3,4-thiadiazol-2-yl) 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzenecarbothioate |
|---|---|
| PubChem CID | 71510011 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | S-(5-methyl-1,3,4-thiadiazol-2-yl) 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzenecarbothioate |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(C(=O)Sc4nnc(C)s4)cc3)no2)cc1 |
| InChI | InChI=1S/C24H23N3O3S2/c1-3-4-5-14-29-20-12-10-18(11-13-20)22-15-21(27-30-22)17-6-8-19(9-7-17)23(28)32-24-26-25-16(2)31-24/h6-13,15H,3-5,14H2,1-2H3 |
| InChIKey | IBTJCJQVHBJNCC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|