C43H45NO9 — CID 158232322
methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate;4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid (PubChem CID 158232322) has the molecular formula C43H45NO9 and a molecular weight of 719.83 g/mol. Its IUPAC name is methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate;4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid.
| Compound Name | methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate;4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 158232322 |
| Molecular Formula | C43H45NO9 |
| Molecular Weight | 719.83 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate;4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(C(=O)O)cc3)no2)cc1.CCCCCOc1ccc(C(=O)CC(=O)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C22H24O5.C21H21NO4/c1-3-4-5-14-27-19-12-10-17(11-13-19)21(24)15-20(23)16-6-8-18(9-7-16)22(25)26-2;1-2-3-4-13-25-18-11-9-16(10-12-18)20-14-19(22-26-20)15-5-7-17(8-6-15)21(23)24/h6-13H,3-5,14-15H2,1-2H3;5-12,14H,2-4,13H2,1H3,(H,23,24) |
| InChIKey | GENJNYVOASLVLN-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.83 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|