C36H51NO5 — CID 102279891
(4-decoxyphenyl) 3-(4-decoxyphenyl)-1,2-oxazole-5-carboxylate (PubChem CID 102279891) has the molecular formula C36H51NO5 and a molecular weight of 577.81 g/mol. Its IUPAC name is (4-decoxyphenyl) 3-(4-decoxyphenyl)-1,2-oxazole-5-carboxylate.
| Compound Name | (4-decoxyphenyl) 3-(4-decoxyphenyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 102279891 |
| Molecular Formula | C36H51NO5 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.38 |
| IUPAC Name | (4-decoxyphenyl) 3-(4-decoxyphenyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2cc(-c3ccc(OCCCCCCCCCC)cc3)no2)cc1 |
| InChI | InChI=1S/C36H51NO5/c1-3-5-7-9-11-13-15-17-27-39-31-21-19-30(20-22-31)34-29-35(42-37-34)36(38)41-33-25-23-32(24-26-33)40-28-18-16-14-12-10-8-6-4-2/h19-26,29H,3-18,27-28H2,1-2H3 |
| InChIKey | XXIXSPGXMJKIRI-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|